C11H4BrF9N2O2 — CID 3095776
N-(5-bromo-2-pyridinyl)-2,2-difluoro-2-(2,3,3,4,4,5,5-heptafluorooxolan-2-yl)acetamide (PubChem CID 3095776) has the molecular formula C11H4BrF9N2O2 and a molecular weight of 447.05 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-2,2-difluoro-2-(2,3,3,4,4,5,5-heptafluorooxolan-2-yl)acetamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-2,2-difluoro-2-(2,3,3,4,4,5,5-heptafluorooxolan-2-yl)acetamide |
|---|---|
| PubChem CID | 3095776 |
| Molecular Formula | C11H4BrF9N2O2 |
| Molecular Weight | 447.05 g/mol |
| Exact Mass | 445.93 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-2,2-difluoro-2-(2,3,3,4,4,5,5-heptafluorooxolan-2-yl)acetamide |
| SMILES | O=C(Nc1ccc(Br)cn1)C(F)(F)C1(F)OC(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11H4BrF9N2O2/c12-4-1-2-5(22-3-4)23-6(24)7(13,14)10(19)8(15,16)9(17,18)11(20,21)25-10/h1-3H,(H,22,23,24) |
| InChIKey | UBEROCLVUFCKCL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.05 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|