C22H31N3OS — CID 30961220
1-benzyl-N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]piperidin-4-amine (PubChem CID 30961220) has the molecular formula C22H31N3OS and a molecular weight of 385.58 g/mol. Its IUPAC name is 1-benzyl-N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]piperidin-4-amine.
| Compound Name | 1-benzyl-N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]piperidin-4-amine |
|---|---|
| PubChem CID | 30961220 |
| Molecular Formula | C22H31N3OS |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 1-benzyl-N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]piperidin-4-amine |
| SMILES | c1ccc(CN2CCC(NC[C@@H](c3cccs3)N3CCOCC3)CC2)cc1 |
| InChI | InChI=1S/C22H31N3OS/c1-2-5-19(6-3-1)18-24-10-8-20(9-11-24)23-17-21(22-7-4-16-27-22)25-12-14-26-15-13-25/h1-7,16,20-21,23H,8-15,17-18H2/t21-/m0/s1 |
| InChIKey | INYHDSLJLLDDHF-NRFANRHFSA-N |
| XLogP | 3.38 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |