About Phenol, 4-(5-nitro-1H-benzimidazol-2-yl)-
Phenol, 4-(5-nitro-1H-benzimidazol-2-yl)- (PubChem CID 3096138) has the molecular formula C13H9N3O3
and a molecular weight of 255.23 g/mol. Its IUPAC name is 4-(6-nitro-1H-benzimidazol-2-yl)phenol.
Molecular Properties
| Compound Name | Phenol, 4-(5-nitro-1H-benzimidazol-2-yl)- |
| PubChem CID | 3096138 |
| Molecular Formula | C13H9N3O3 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 4-(6-nitro-1H-benzimidazol-2-yl)phenol |
| SMILES | C1=CC(=CC=C1C2=NC3=C(N2)C=C(C=C3)[N+](=O)[O-])O |
| InChI | InChI=1S/C13H9N3O3/c17-10-4-1-8(2-5-10)13-14-11-6-3-9(16(18)19)7-12(11)15-13/h1-7,17H,(H,14,15) |
| InChIKey | QPAUGSYVFGVSOV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | 339 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze Phenol, 4-(5-nitro-1H-benzimidazol-2-yl)- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Phenol, 4-(5-nitro-1H-benzimidazol-2-yl)-?
The IUPAC name of Phenol, 4-(5-nitro-1H-benzimidazol-2-yl)- (CID 3096138) is 4-(6-nitro-1H-benzimidazol-2-yl)phenol.
What is the SMILES notation for Phenol, 4-(5-nitro-1H-benzimidazol-2-yl)-?
The canonical SMILES for Phenol, 4-(5-nitro-1H-benzimidazol-2-yl)- is C1=CC(=CC=C1C2=NC3=C(N2)C=C(C=C3)[N+](=O)[O-])O.
What is the InChIKey of Phenol, 4-(5-nitro-1H-benzimidazol-2-yl)-?
The InChIKey is QPAUGSYVFGVSOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3O3/c17-10-4-1-8(2-5-10)13-14-11-6-3-9(16(18)19)7-12(11)15-13/h1-7,17H,(H,14,15).
What are the key properties of Phenol, 4-(5-nitro-1H-benzimidazol-2-yl)-?
Phenol, 4-(5-nitro-1H-benzimidazol-2-yl)- has a molecular weight of 255.23 g/mol, XLogP of 3.10, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Phenol, 4-(5-nitro-1H-benzimidazol-2-yl)- is sourced from PubChem (CID 3096138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).