C9H11NO3 — CID 3097715
2-methyl-4,6,7,7a-tetrahydro-3aH-isoindole-1,3,5-trione (PubChem CID 3097715) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is 2-methyl-4,6,7,7a-tetrahydro-3aH-isoindole-1,3,5-trione.
| Compound Name | 2-methyl-4,6,7,7a-tetrahydro-3aH-isoindole-1,3,5-trione |
|---|---|
| PubChem CID | 3097715 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 2-methyl-4,6,7,7a-tetrahydro-3aH-isoindole-1,3,5-trione |
| SMILES | CN1C(=O)C2CCC(=O)CC2C1=O |
| InChI | InChI=1S/C9H11NO3/c1-10-8(12)6-3-2-5(11)4-7(6)9(10)13/h6-7H,2-4H2,1H3 |
| InChIKey | LQUMXWLZVBWOTL-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|