About N-(2-chlorophenyl)-3,5-dinitropyridin-4-amine
N-(2-chlorophenyl)-3,5-dinitropyridin-4-amine (PubChem CID 3097923) has the molecular formula C11H7ClN4O4
and a molecular weight of 294.65 g/mol. Its IUPAC name is N-(2-chlorophenyl)-3,5-dinitropyridin-4-amine.
Molecular Properties
| Compound Name | N-(2-chlorophenyl)-3,5-dinitropyridin-4-amine |
| PubChem CID | 3097923 |
| Molecular Formula | C11H7ClN4O4 |
| Molecular Weight | 294.65 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | N-(2-chlorophenyl)-3,5-dinitropyridin-4-amine |
| SMILES | O=[N+]([O-])c1cncc([N+](=O)[O-])c1Nc1ccccc1Cl |
| InChI | InChI=1S/C11H7ClN4O4/c12-7-3-1-2-4-8(7)14-11-9(15(17)18)5-13-6-10(11)16(19)20/h1-6H,(H,13,14) |
| InChIKey | SYDNVZOSGOWCBQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 111.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.65 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chlorophenyl)-3,5-dinitropyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chlorophenyl)-3,5-dinitropyridin-4-amine?
The IUPAC name of N-(2-chlorophenyl)-3,5-dinitropyridin-4-amine (CID 3097923) is N-(2-chlorophenyl)-3,5-dinitropyridin-4-amine.
What is the SMILES notation for N-(2-chlorophenyl)-3,5-dinitropyridin-4-amine?
The canonical SMILES for N-(2-chlorophenyl)-3,5-dinitropyridin-4-amine is O=[N+]([O-])c1cncc([N+](=O)[O-])c1Nc1ccccc1Cl.
What is the InChIKey of N-(2-chlorophenyl)-3,5-dinitropyridin-4-amine?
The InChIKey is SYDNVZOSGOWCBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7ClN4O4/c12-7-3-1-2-4-8(7)14-11-9(15(17)18)5-13-6-10(11)16(19)20/h1-6H,(H,13,14).
What are the key properties of N-(2-chlorophenyl)-3,5-dinitropyridin-4-amine?
N-(2-chlorophenyl)-3,5-dinitropyridin-4-amine has a molecular weight of 294.65 g/mol, XLogP of 3.30, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chlorophenyl)-3,5-dinitropyridin-4-amine is sourced from PubChem (CID 3097923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).