About 2-(3,4-dimethylanilino)-5-(hydroxymethyl)oxolane-3,4-diol
2-(3,4-dimethylanilino)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 3098011) has the molecular formula C13H19NO4
and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-(3,4-dimethylanilino)-5-(hydroxymethyl)oxolane-3,4-diol.
Molecular Properties
| Compound Name | 2-(3,4-dimethylanilino)-5-(hydroxymethyl)oxolane-3,4-diol |
| PubChem CID | 3098011 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 2-(3,4-dimethylanilino)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Cc1ccc(NC2OC(CO)C(O)C2O)cc1C |
| InChI | InChI=1S/C13H19NO4/c1-7-3-4-9(5-8(7)2)14-13-12(17)11(16)10(6-15)18-13/h3-5,10-17H,6H2,1-2H3 |
| InChIKey | VFSWYCIABRLYJU-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3,4-dimethylanilino)-5-(hydroxymethyl)oxolane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethylanilino)-5-(hydroxymethyl)oxolane-3,4-diol?
The IUPAC name of 2-(3,4-dimethylanilino)-5-(hydroxymethyl)oxolane-3,4-diol (CID 3098011) is 2-(3,4-dimethylanilino)-5-(hydroxymethyl)oxolane-3,4-diol.
What is the SMILES notation for 2-(3,4-dimethylanilino)-5-(hydroxymethyl)oxolane-3,4-diol?
The canonical SMILES for 2-(3,4-dimethylanilino)-5-(hydroxymethyl)oxolane-3,4-diol is Cc1ccc(NC2OC(CO)C(O)C2O)cc1C.
What is the InChIKey of 2-(3,4-dimethylanilino)-5-(hydroxymethyl)oxolane-3,4-diol?
The InChIKey is VFSWYCIABRLYJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO4/c1-7-3-4-9(5-8(7)2)14-13-12(17)11(16)10(6-15)18-13/h3-5,10-17H,6H2,1-2H3.
What are the key properties of 2-(3,4-dimethylanilino)-5-(hydroxymethyl)oxolane-3,4-diol?
2-(3,4-dimethylanilino)-5-(hydroxymethyl)oxolane-3,4-diol has a molecular weight of 253.30 g/mol, XLogP of 0.15, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethylanilino)-5-(hydroxymethyl)oxolane-3,4-diol is sourced from PubChem (CID 3098011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).