About 1,2,4,5-tetraphenylimidazole
1,2,4,5-tetraphenylimidazole (PubChem CID 3098021) has the molecular formula C27H20N2
and a molecular weight of 372.47 g/mol. Its IUPAC name is 1,2,4,5-tetraphenylimidazole.
Molecular Properties
| Compound Name | 1,2,4,5-tetraphenylimidazole |
| PubChem CID | 3098021 |
| Molecular Formula | C27H20N2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 1,2,4,5-tetraphenylimidazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)n(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H20N2/c1-5-13-21(14-6-1)25-26(22-15-7-2-8-16-22)29(24-19-11-4-12-20-24)27(28-25)23-17-9-3-10-18-23/h1-20H |
| InChIKey | NTMHHCYWWRIYIP-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2,4,5-tetraphenylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,4,5-tetraphenylimidazole?
The IUPAC name of 1,2,4,5-tetraphenylimidazole (CID 3098021) is 1,2,4,5-tetraphenylimidazole.
What is the SMILES notation for 1,2,4,5-tetraphenylimidazole?
The canonical SMILES for 1,2,4,5-tetraphenylimidazole is c1ccc(-c2nc(-c3ccccc3)n(-c3ccccc3)c2-c2ccccc2)cc1.
What is the InChIKey of 1,2,4,5-tetraphenylimidazole?
The InChIKey is NTMHHCYWWRIYIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H20N2/c1-5-13-21(14-6-1)25-26(22-15-7-2-8-16-22)29(24-19-11-4-12-20-24)27(28-25)23-17-9-3-10-18-23/h1-20H.
What are the key properties of 1,2,4,5-tetraphenylimidazole?
1,2,4,5-tetraphenylimidazole has a molecular weight of 372.47 g/mol, XLogP of 6.87, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,4,5-tetraphenylimidazole is sourced from PubChem (CID 3098021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).