About N-dibenzofuran-3-yl-2,2,2-trifluoroacetamide
N-dibenzofuran-3-yl-2,2,2-trifluoroacetamide (PubChem CID 3098056) has the molecular formula C14H8F3NO2
and a molecular weight of 279.22 g/mol. Its IUPAC name is N-dibenzofuran-3-yl-2,2,2-trifluoroacetamide.
Molecular Properties
| Compound Name | N-dibenzofuran-3-yl-2,2,2-trifluoroacetamide |
| PubChem CID | 3098056 |
| Molecular Formula | C14H8F3NO2 |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | N-dibenzofuran-3-yl-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1ccc2c(c1)oc1ccccc12)C(F)(F)F |
| InChI | InChI=1S/C14H8F3NO2/c15-14(16,17)13(19)18-8-5-6-10-9-3-1-2-4-11(9)20-12(10)7-8/h1-7H,(H,18,19) |
| InChIKey | UEGXRQSEKBPMEY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-dibenzofuran-3-yl-2,2,2-trifluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-dibenzofuran-3-yl-2,2,2-trifluoroacetamide?
The IUPAC name of N-dibenzofuran-3-yl-2,2,2-trifluoroacetamide (CID 3098056) is N-dibenzofuran-3-yl-2,2,2-trifluoroacetamide.
What is the SMILES notation for N-dibenzofuran-3-yl-2,2,2-trifluoroacetamide?
The canonical SMILES for N-dibenzofuran-3-yl-2,2,2-trifluoroacetamide is O=C(Nc1ccc2c(c1)oc1ccccc12)C(F)(F)F.
What is the InChIKey of N-dibenzofuran-3-yl-2,2,2-trifluoroacetamide?
The InChIKey is UEGXRQSEKBPMEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8F3NO2/c15-14(16,17)13(19)18-8-5-6-10-9-3-1-2-4-11(9)20-12(10)7-8/h1-7H,(H,18,19).
What are the key properties of N-dibenzofuran-3-yl-2,2,2-trifluoroacetamide?
N-dibenzofuran-3-yl-2,2,2-trifluoroacetamide has a molecular weight of 279.22 g/mol, XLogP of 4.09, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-dibenzofuran-3-yl-2,2,2-trifluoroacetamide is sourced from PubChem (CID 3098056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).