C21H19N3O3S2 — CID 3098134
(5Z)-2-(3-hydroxyphenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 3098134) has the molecular formula C21H19N3O3S2 and a molecular weight of 425.54 g/mol. Its IUPAC name is (5Z)-2-(3-hydroxyphenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(3-hydroxyphenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3098134 |
| Molecular Formula | C21H19N3O3S2 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | (5Z)-2-(3-hydroxyphenyl)imino-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)/C(=C2/Sc3ccc(OC)cc3N2C)S/C1=N\c1cccc(O)c1 |
| InChI | InChI=1S/C21H19N3O3S2/c1-4-10-24-19(26)18(29-21(24)22-13-6-5-7-14(25)11-13)20-23(2)16-12-15(27-3)8-9-17(16)28-20/h4-9,11-12,25H,1,10H2,2-3H3/b20-18-,22-21- |
| InChIKey | JNFRWTHMLBAFLT-QHQVFXOCSA-N |
| XLogP | 4.56 |
| TPSA | 65.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|