About [(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-fluorobenzoate
[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-fluorobenzoate (PubChem CID 3098251) has the molecular formula C17H20FNO2
and a molecular weight of 289.35 g/mol. Its IUPAC name is [(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-fluorobenzoate.
Molecular Properties
| Compound Name | [(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-fluorobenzoate |
| PubChem CID | 3098251 |
| Molecular Formula | C17H20FNO2 |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | [(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-fluorobenzoate |
| SMILES | CC12CCC(CC1=NOC(=O)c1ccc(F)cc1)C2(C)C |
| InChI | InChI=1S/C17H20FNO2/c1-16(2)12-8-9-17(16,3)14(10-12)19-21-15(20)11-4-6-13(18)7-5-11/h4-7,12H,8-10H2,1-3H3 |
| InChIKey | PQAMVPPCXDLVCM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-fluorobenzoate?
The IUPAC name of [(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-fluorobenzoate (CID 3098251) is [(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-fluorobenzoate.
What is the SMILES notation for [(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-fluorobenzoate?
The canonical SMILES for [(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-fluorobenzoate is CC12CCC(CC1=NOC(=O)c1ccc(F)cc1)C2(C)C.
What is the InChIKey of [(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-fluorobenzoate?
The InChIKey is PQAMVPPCXDLVCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20FNO2/c1-16(2)12-8-9-17(16,3)14(10-12)19-21-15(20)11-4-6-13(18)7-5-11/h4-7,12H,8-10H2,1-3H3.
What are the key properties of [(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-fluorobenzoate?
[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-fluorobenzoate has a molecular weight of 289.35 g/mol, XLogP of 4.18, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-fluorobenzoate is sourced from PubChem (CID 3098251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).