C17H27NO2 — CID 30982517
[(3R)-1-[(2S)-4-(4-methoxyphenyl)butan-2-yl]piperidin-3-yl]methanol (PubChem CID 30982517) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is [(3R)-1-[(2S)-4-(4-methoxyphenyl)butan-2-yl]piperidin-3-yl]methanol.
| Compound Name | [(3R)-1-[(2S)-4-(4-methoxyphenyl)butan-2-yl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 30982517 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | [(3R)-1-[(2S)-4-(4-methoxyphenyl)butan-2-yl]piperidin-3-yl]methanol |
| SMILES | COc1ccc(CC[C@H](C)N2CCC[C@@H](CO)C2)cc1 |
| InChI | InChI=1S/C17H27NO2/c1-14(18-11-3-4-16(12-18)13-19)5-6-15-7-9-17(20-2)10-8-15/h7-10,14,16,19H,3-6,11-13H2,1-2H3/t14-,16+/m0/s1 |
| InChIKey | OZBWKDNYLWENKI-GOEBONIOSA-N |
| XLogP | 2.72 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |