C15H26N+ — CID 3098406
2-ethyl-4,9b-dimethyl-1,2,3,5,6,7,8,9-octahydrocyclopenta[g]indolizin-4-ium (PubChem CID 3098406) has the molecular formula C15H26N+ and a molecular weight of 220.38 g/mol. Its IUPAC name is 2-ethyl-4,9b-dimethyl-1,2,3,5,6,7,8,9-octahydrocyclopenta[g]indolizin-4-ium.
| Compound Name | 2-ethyl-4,9b-dimethyl-1,2,3,5,6,7,8,9-octahydrocyclopenta[g]indolizin-4-ium |
|---|---|
| PubChem CID | 3098406 |
| Molecular Formula | C15H26N+ |
| Molecular Weight | 220.38 g/mol |
| Exact Mass | 220.21 |
| IUPAC Name | 2-ethyl-4,9b-dimethyl-1,2,3,5,6,7,8,9-octahydrocyclopenta[g]indolizin-4-ium |
| SMILES | CCC1CC2(C)C3=C(CCC3)CC[N+]2(C)C1 |
| InChI | InChI=1S/C15H26N/c1-4-12-10-15(2)14-7-5-6-13(14)8-9-16(15,3)11-12/h12H,4-11H2,1-3H3/q+1 |
| InChIKey | YOCUVURHTLTTOB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|