About 1-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)butane-2-thione
1-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)butane-2-thione (PubChem CID 3098807) has the molecular formula C13H14ClNS2
and a molecular weight of 283.85 g/mol. Its IUPAC name is 1-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)butane-2-thione.
Molecular Properties
| Compound Name | 1-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)butane-2-thione |
| PubChem CID | 3098807 |
| Molecular Formula | C13H14ClNS2 |
| Molecular Weight | 283.85 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | 1-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)butane-2-thione |
| SMILES | CCC(=S)C=C1Sc2ccc(Cl)cc2N1CC |
| InChI | InChI=1S/C13H14ClNS2/c1-3-10(16)8-13-15(4-2)11-7-9(14)5-6-12(11)17-13/h5-8H,3-4H2,1-2H3 |
| InChIKey | BBLSSFFGZOKVSN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.85 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)butane-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)butane-2-thione?
The IUPAC name of 1-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)butane-2-thione (CID 3098807) is 1-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)butane-2-thione.
What is the SMILES notation for 1-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)butane-2-thione?
The canonical SMILES for 1-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)butane-2-thione is CCC(=S)C=C1Sc2ccc(Cl)cc2N1CC.
What is the InChIKey of 1-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)butane-2-thione?
The InChIKey is BBLSSFFGZOKVSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClNS2/c1-3-10(16)8-13-15(4-2)11-7-9(14)5-6-12(11)17-13/h5-8H,3-4H2,1-2H3.
What are the key properties of 1-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)butane-2-thione?
1-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)butane-2-thione has a molecular weight of 283.85 g/mol, XLogP of 4.89, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)butane-2-thione is sourced from PubChem (CID 3098807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).