C17H32N4O2 — CID 30988484
(2R)-N-cyclohexyl-2-[4-[2-(dimethylamino)-2-oxoethyl]piperazin-1-yl]propanamide (PubChem CID 30988484) has the molecular formula C17H32N4O2 and a molecular weight of 324.47 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-2-[4-[2-(dimethylamino)-2-oxoethyl]piperazin-1-yl]propanamide.
| Compound Name | (2R)-N-cyclohexyl-2-[4-[2-(dimethylamino)-2-oxoethyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 30988484 |
| Molecular Formula | C17H32N4O2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | (2R)-N-cyclohexyl-2-[4-[2-(dimethylamino)-2-oxoethyl]piperazin-1-yl]propanamide |
| SMILES | C[C@H](C(=O)NC1CCCCC1)N1CCN(CC(=O)N(C)C)CC1 |
| InChI | InChI=1S/C17H32N4O2/c1-14(17(23)18-15-7-5-4-6-8-15)21-11-9-20(10-12-21)13-16(22)19(2)3/h14-15H,4-13H2,1-3H3,(H,18,23)/t14-/m1/s1 |
| InChIKey | AXRQBILHHYCTNK-CQSZACIVSA-N |
| XLogP | 0.53 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |