About 4-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]morpholine
4-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]morpholine (PubChem CID 3099054) has the molecular formula C13H17N5O
and a molecular weight of 259.31 g/mol. Its IUPAC name is 4-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]morpholine.
Molecular Properties
| Compound Name | 4-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]morpholine |
| PubChem CID | 3099054 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 4-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]morpholine |
| SMILES | Cc1cc(C)n(-c2ccc(N3CCOCC3)nn2)n1 |
| InChI | InChI=1S/C13H17N5O/c1-10-9-11(2)18(16-10)13-4-3-12(14-15-13)17-5-7-19-8-6-17/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | GVLONADNZUMIGN-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]morpholine?
The IUPAC name of 4-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]morpholine (CID 3099054) is 4-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]morpholine.
What is the SMILES notation for 4-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]morpholine?
The canonical SMILES for 4-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]morpholine is Cc1cc(C)n(-c2ccc(N3CCOCC3)nn2)n1.
What is the InChIKey of 4-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]morpholine?
The InChIKey is GVLONADNZUMIGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N5O/c1-10-9-11(2)18(16-10)13-4-3-12(14-15-13)17-5-7-19-8-6-17/h3-4,9H,5-8H2,1-2H3.
What are the key properties of 4-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]morpholine?
4-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]morpholine has a molecular weight of 259.31 g/mol, XLogP of 1.12, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]morpholine is sourced from PubChem (CID 3099054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).