C16H22N2O3 — CID 30991388
(2R)-4-acetyl-N-pentyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 30991388) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is (2R)-4-acetyl-N-pentyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | (2R)-4-acetyl-N-pentyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 30991388 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | (2R)-4-acetyl-N-pentyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CCCCCNC(=O)[C@H]1CN(C(C)=O)c2ccccc2O1 |
| InChI | InChI=1S/C16H22N2O3/c1-3-4-7-10-17-16(20)15-11-18(12(2)19)13-8-5-6-9-14(13)21-15/h5-6,8-9,15H,3-4,7,10-11H2,1-2H3,(H,17,20)/t15-/m1/s1 |
| InChIKey | QLSBXDXOKVCBSC-OAHLLOKOSA-N |
| XLogP | 2.11 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|