About N-(3-hydroxypropyl)-N'-prop-2-enyloxamide
N-(3-hydroxypropyl)-N'-prop-2-enyloxamide (PubChem CID 3099196) has the molecular formula C8H14N2O3
and a molecular weight of 186.21 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-N'-prop-2-enyloxamide.
Molecular Properties
| Compound Name | N-(3-hydroxypropyl)-N'-prop-2-enyloxamide |
| PubChem CID | 3099196 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | N-(3-hydroxypropyl)-N'-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(=O)NCCCO |
| InChI | InChI=1S/C8H14N2O3/c1-2-4-9-7(12)8(13)10-5-3-6-11/h2,11H,1,3-6H2,(H,9,12)(H,10,13) |
| InChIKey | RMARJJJRDHSOQT-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(3-hydroxypropyl)-N'-prop-2-enyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-hydroxypropyl)-N'-prop-2-enyloxamide?
The IUPAC name of N-(3-hydroxypropyl)-N'-prop-2-enyloxamide (CID 3099196) is N-(3-hydroxypropyl)-N'-prop-2-enyloxamide.
What is the SMILES notation for N-(3-hydroxypropyl)-N'-prop-2-enyloxamide?
The canonical SMILES for N-(3-hydroxypropyl)-N'-prop-2-enyloxamide is C=CCNC(=O)C(=O)NCCCO.
What is the InChIKey of N-(3-hydroxypropyl)-N'-prop-2-enyloxamide?
The InChIKey is RMARJJJRDHSOQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O3/c1-2-4-9-7(12)8(13)10-5-3-6-11/h2,11H,1,3-6H2,(H,9,12)(H,10,13).
What are the key properties of N-(3-hydroxypropyl)-N'-prop-2-enyloxamide?
N-(3-hydroxypropyl)-N'-prop-2-enyloxamide has a molecular weight of 186.21 g/mol, XLogP of -1.21, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-hydroxypropyl)-N'-prop-2-enyloxamide is sourced from PubChem (CID 3099196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).