C15H9Br3N4OS — CID 3099250
3-phenyl-4-[(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 3099250) has the molecular formula C15H9Br3N4OS and a molecular weight of 533.04 g/mol. Its IUPAC name is 3-phenyl-4-[(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-phenyl-4-[(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 3099250 |
| Molecular Formula | C15H9Br3N4OS |
| Molecular Weight | 533.04 g/mol |
| Exact Mass | 529.80 |
| IUPAC Name | 3-phenyl-4-[(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | Oc1c(Br)cc(Br)c(C=Nn2c(-c3ccccc3)n[nH]c2=S)c1Br |
| InChI | InChI=1S/C15H9Br3N4OS/c16-10-6-11(17)13(23)12(18)9(10)7-19-22-14(20-21-15(22)24)8-4-2-1-3-5-8/h1-7,23H,(H,21,24) |
| InChIKey | ZEZCBQRHYPXYGH-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 66.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.04 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|