C21H21N5O3 — CID 30992875
N'-(oxane-4-carbonyl)-1,5-diphenyl-1,2,4-triazole-3-carbohydrazide (PubChem CID 30992875) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is N'-(oxane-4-carbonyl)-1,5-diphenyl-1,2,4-triazole-3-carbohydrazide.
| Compound Name | N'-(oxane-4-carbonyl)-1,5-diphenyl-1,2,4-triazole-3-carbohydrazide |
|---|---|
| PubChem CID | 30992875 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N'-(oxane-4-carbonyl)-1,5-diphenyl-1,2,4-triazole-3-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCOCC1)c1nc(-c2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H21N5O3/c27-20(16-11-13-29-14-12-16)23-24-21(28)18-22-19(15-7-3-1-4-8-15)26(25-18)17-9-5-2-6-10-17/h1-10,16H,11-14H2,(H,23,27)(H,24,28) |
| InChIKey | CHARNHZKIDYZMV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|