C16H22N4O5 — CID 3099465
6a-morpholin-4-yl-3,6-dioxido-5,7,8,9,10,10a-hexahydro-4H-[1,2,5]oxadiazolo[3,4-c]carbazole-3,6-diium-10b-ol (PubChem CID 3099465) has the molecular formula C16H22N4O5 and a molecular weight of 350.38 g/mol. Its IUPAC name is 6a-morpholin-4-yl-3,6-dioxido-5,7,8,9,10,10a-hexahydro-4H-[1,2,5]oxadiazolo[3,4-c]carbazole-3,6-diium-10b-ol.
| Compound Name | 6a-morpholin-4-yl-3,6-dioxido-5,7,8,9,10,10a-hexahydro-4H-[1,2,5]oxadiazolo[3,4-c]carbazole-3,6-diium-10b-ol |
|---|---|
| PubChem CID | 3099465 |
| Molecular Formula | C16H22N4O5 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 6a-morpholin-4-yl-3,6-dioxido-5,7,8,9,10,10a-hexahydro-4H-[1,2,5]oxadiazolo[3,4-c]carbazole-3,6-diium-10b-ol |
| SMILES | [O-][N+]1=C2CCc3c(no[n+]3[O-])C2(O)C2CCCCC21N1CCOCC1 |
| InChI | InChI=1S/C16H22N4O5/c21-16-12-3-1-2-6-15(12,18-7-9-24-10-8-18)19(22)13(16)5-4-11-14(16)17-25-20(11)23/h12,21H,1-10H2 |
| InChIKey | PBHMCURDJGREHE-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 111.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|