C17H11FN8O4 — CID 3099787
2-[[[6-(4-fluoroanilino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]-6-nitrophenol (PubChem CID 3099787) has the molecular formula C17H11FN8O4 and a molecular weight of 410.33 g/mol. Its IUPAC name is 2-[[[6-(4-fluoroanilino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]-6-nitrophenol.
| Compound Name | 2-[[[6-(4-fluoroanilino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]-6-nitrophenol |
|---|---|
| PubChem CID | 3099787 |
| Molecular Formula | C17H11FN8O4 |
| Molecular Weight | 410.33 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 2-[[[6-(4-fluoroanilino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]-6-nitrophenol |
| SMILES | O=[N+]([O-])c1cccc(C=NNc2nc3nonc3nc2Nc2ccc(F)cc2)c1O |
| InChI | InChI=1S/C17H11FN8O4/c18-10-4-6-11(7-5-10)20-14-15(22-17-16(21-14)24-30-25-17)23-19-8-9-2-1-3-12(13(9)27)26(28)29/h1-8,27H,(H,20,21,24)(H,22,23,25) |
| InChIKey | XCXJLOIPOQMMNV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 164.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|