C7H7F8NO2 — CID 3099800
N-(2,2,3,3,4,4,5,5-octafluoro-1-hydroxypentyl)acetamide (PubChem CID 3099800) has the molecular formula C7H7F8NO2 and a molecular weight of 289.12 g/mol. Its IUPAC name is N-(2,2,3,3,4,4,5,5-octafluoro-1-hydroxypentyl)acetamide.
| Compound Name | N-(2,2,3,3,4,4,5,5-octafluoro-1-hydroxypentyl)acetamide |
|---|---|
| PubChem CID | 3099800 |
| Molecular Formula | C7H7F8NO2 |
| Molecular Weight | 289.12 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | N-(2,2,3,3,4,4,5,5-octafluoro-1-hydroxypentyl)acetamide |
| SMILES | CC(=O)NC(O)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H7F8NO2/c1-2(17)16-4(18)6(12,13)7(14,15)5(10,11)3(8)9/h3-4,18H,1H3,(H,16,17) |
| InChIKey | OYBMHXSDOBGNLV-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.12 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|