C17H15ClFN5OS — CID 30999700
2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-[(4-fluoro-3-methylphenyl)methyl]acetamide (PubChem CID 30999700) has the molecular formula C17H15ClFN5OS and a molecular weight of 391.86 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-[(4-fluoro-3-methylphenyl)methyl]acetamide.
| Compound Name | 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-[(4-fluoro-3-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 30999700 |
| Molecular Formula | C17H15ClFN5OS |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-[(4-fluoro-3-methylphenyl)methyl]acetamide |
| SMILES | Cc1cc(CNC(=O)CSc2nnnn2-c2ccc(Cl)cc2)ccc1F |
| InChI | InChI=1S/C17H15ClFN5OS/c1-11-8-12(2-7-15(11)19)9-20-16(25)10-26-17-21-22-23-24(17)14-5-3-13(18)4-6-14/h2-8H,9-10H2,1H3,(H,20,25) |
| InChIKey | KCLQYTXMPYFOME-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |