About 2-(4-methylphenyl)-6,7-dinitrobenzo[de]isoquinoline-1,3-dione
2-(4-methylphenyl)-6,7-dinitrobenzo[de]isoquinoline-1,3-dione (PubChem CID 3100164) has the molecular formula C19H11N3O6
and a molecular weight of 377.31 g/mol. Its IUPAC name is 2-(4-methylphenyl)-6,7-dinitrobenzo[de]isoquinoline-1,3-dione.
Molecular Properties
| Compound Name | 2-(4-methylphenyl)-6,7-dinitrobenzo[de]isoquinoline-1,3-dione |
| PubChem CID | 3100164 |
| Molecular Formula | C19H11N3O6 |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 2-(4-methylphenyl)-6,7-dinitrobenzo[de]isoquinoline-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)c3ccc([N+](=O)[O-])c4c([N+](=O)[O-])ccc(c34)C2=O)cc1 |
| InChI | InChI=1S/C19H11N3O6/c1-10-2-4-11(5-3-10)20-18(23)12-6-8-14(21(25)26)17-15(22(27)28)9-7-13(16(12)17)19(20)24/h2-9H,1H3 |
| InChIKey | SDPCQGWBQZKBTB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methylphenyl)-6,7-dinitrobenzo[de]isoquinoline-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenyl)-6,7-dinitrobenzo[de]isoquinoline-1,3-dione?
The IUPAC name of 2-(4-methylphenyl)-6,7-dinitrobenzo[de]isoquinoline-1,3-dione (CID 3100164) is 2-(4-methylphenyl)-6,7-dinitrobenzo[de]isoquinoline-1,3-dione.
What is the SMILES notation for 2-(4-methylphenyl)-6,7-dinitrobenzo[de]isoquinoline-1,3-dione?
The canonical SMILES for 2-(4-methylphenyl)-6,7-dinitrobenzo[de]isoquinoline-1,3-dione is Cc1ccc(N2C(=O)c3ccc([N+](=O)[O-])c4c([N+](=O)[O-])ccc(c34)C2=O)cc1.
What is the InChIKey of 2-(4-methylphenyl)-6,7-dinitrobenzo[de]isoquinoline-1,3-dione?
The InChIKey is SDPCQGWBQZKBTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11N3O6/c1-10-2-4-11(5-3-10)20-18(23)12-6-8-14(21(25)26)17-15(22(27)28)9-7-13(16(12)17)19(20)24/h2-9H,1H3.
What are the key properties of 2-(4-methylphenyl)-6,7-dinitrobenzo[de]isoquinoline-1,3-dione?
2-(4-methylphenyl)-6,7-dinitrobenzo[de]isoquinoline-1,3-dione has a molecular weight of 377.31 g/mol, XLogP of 3.77, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenyl)-6,7-dinitrobenzo[de]isoquinoline-1,3-dione is sourced from PubChem (CID 3100164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).