C25H22N2O8 — CID 3100254
2-[7-(5-carboxy-1,3-dioxoisoindol-2-yl)heptyl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 3100254) has the molecular formula C25H22N2O8 and a molecular weight of 478.46 g/mol. Its IUPAC name is 2-[7-(5-carboxy-1,3-dioxoisoindol-2-yl)heptyl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[7-(5-carboxy-1,3-dioxoisoindol-2-yl)heptyl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 3100254 |
| Molecular Formula | C25H22N2O8 |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 2-[7-(5-carboxy-1,3-dioxoisoindol-2-yl)heptyl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)N(CCCCCCCN1C(=O)c3ccc(C(=O)O)cc3C1=O)C2=O |
| InChI | InChI=1S/C25H22N2O8/c28-20-16-8-6-14(24(32)33)12-18(16)22(30)26(20)10-4-2-1-3-5-11-27-21(29)17-9-7-15(25(34)35)13-19(17)23(27)31/h6-9,12-13H,1-5,10-11H2,(H,32,33)(H,34,35) |
| InChIKey | KZPSPDOOUWPINU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 149.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|