C19H25NO — CID 3100410
(3Z)-3-[(3,4-dimethylanilino)methylidene]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 3100410) has the molecular formula C19H25NO and a molecular weight of 283.42 g/mol. Its IUPAC name is (3Z)-3-[(3,4-dimethylanilino)methylidene]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | (3Z)-3-[(3,4-dimethylanilino)methylidene]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 3100410 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | (3Z)-3-[(3,4-dimethylanilino)methylidene]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | Cc1ccc(N/C=C2\C(=O)C3(C)CCC2C3(C)C)cc1C |
| InChI | InChI=1S/C19H25NO/c1-12-6-7-14(10-13(12)2)20-11-15-16-8-9-19(5,17(15)21)18(16,3)4/h6-7,10-11,16,20H,8-9H2,1-5H3/b15-11- |
| InChIKey | BCFQNBKACBVJKN-PTNGSMBKSA-N |
| XLogP | 4.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|