About 4-ethoxycarbonyl-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]hexanoic acid
4-ethoxycarbonyl-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]hexanoic acid (PubChem CID 3100701) has the molecular formula C19H24N2O4S
and a molecular weight of 376.48 g/mol. Its IUPAC name is 4-ethoxycarbonyl-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]hexanoic acid.
Molecular Properties
| Compound Name | 4-ethoxycarbonyl-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]hexanoic acid |
| PubChem CID | 3100701 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 4-ethoxycarbonyl-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]hexanoic acid |
| SMILES | CCOC(=O)C(CC)(CCC(=O)O)c1csc(Nc2ccc(C)cc2)n1 |
| InChI | InChI=1S/C19H24N2O4S/c1-4-19(11-10-16(22)23,17(24)25-5-2)15-12-26-18(21-15)20-14-8-6-13(3)7-9-14/h6-9,12H,4-5,10-11H2,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | JKTARFLEFLYTKQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-ethoxycarbonyl-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxycarbonyl-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]hexanoic acid?
The IUPAC name of 4-ethoxycarbonyl-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]hexanoic acid (CID 3100701) is 4-ethoxycarbonyl-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]hexanoic acid.
What is the SMILES notation for 4-ethoxycarbonyl-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]hexanoic acid?
The canonical SMILES for 4-ethoxycarbonyl-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]hexanoic acid is CCOC(=O)C(CC)(CCC(=O)O)c1csc(Nc2ccc(C)cc2)n1.
What is the InChIKey of 4-ethoxycarbonyl-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]hexanoic acid?
The InChIKey is JKTARFLEFLYTKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2O4S/c1-4-19(11-10-16(22)23,17(24)25-5-2)15-12-26-18(21-15)20-14-8-6-13(3)7-9-14/h6-9,12H,4-5,10-11H2,1-3H3,(H,20,21)(H,22,23).
What are the key properties of 4-ethoxycarbonyl-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]hexanoic acid?
4-ethoxycarbonyl-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]hexanoic acid has a molecular weight of 376.48 g/mol, XLogP of 4.27, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxycarbonyl-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]hexanoic acid is sourced from PubChem (CID 3100701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).