C12H19N7O2 — CID 3100746
methyl 2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-cyanoamino]propanoate (PubChem CID 3100746) has the molecular formula C12H19N7O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is methyl 2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-cyanoamino]propanoate.
| Compound Name | methyl 2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-cyanoamino]propanoate |
|---|---|
| PubChem CID | 3100746 |
| Molecular Formula | C12H19N7O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | methyl 2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-cyanoamino]propanoate |
| SMILES | COC(=O)C(C)N(C#N)c1nc(N(C)C)nc(N(C)C)n1 |
| InChI | InChI=1S/C12H19N7O2/c1-8(9(20)21-6)19(7-13)12-15-10(17(2)3)14-11(16-12)18(4)5/h8H,1-6H3 |
| InChIKey | VGSCFWYKEUVVHX-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 98.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|