About 2-(2,4-dinitroanilino)phenol
2-(2,4-dinitroanilino)phenol (PubChem CID 3100915) has the molecular formula C12H9N3O5
and a molecular weight of 275.22 g/mol. Its IUPAC name is 2-(2,4-dinitroanilino)phenol.
Molecular Properties
| Compound Name | 2-(2,4-dinitroanilino)phenol |
| PubChem CID | 3100915 |
| Molecular Formula | C12H9N3O5 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 2-(2,4-dinitroanilino)phenol |
| SMILES | O=[N+]([O-])c1ccc(Nc2ccccc2O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H9N3O5/c16-12-4-2-1-3-10(12)13-9-6-5-8(14(17)18)7-11(9)15(19)20/h1-7,13,16H |
| InChIKey | IKBVHBLOMZBKQR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-dinitroanilino)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dinitroanilino)phenol?
The IUPAC name of 2-(2,4-dinitroanilino)phenol (CID 3100915) is 2-(2,4-dinitroanilino)phenol.
What is the SMILES notation for 2-(2,4-dinitroanilino)phenol?
The canonical SMILES for 2-(2,4-dinitroanilino)phenol is O=[N+]([O-])c1ccc(Nc2ccccc2O)c([N+](=O)[O-])c1.
What is the InChIKey of 2-(2,4-dinitroanilino)phenol?
The InChIKey is IKBVHBLOMZBKQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3O5/c16-12-4-2-1-3-10(12)13-9-6-5-8(14(17)18)7-11(9)15(19)20/h1-7,13,16H.
What are the key properties of 2-(2,4-dinitroanilino)phenol?
2-(2,4-dinitroanilino)phenol has a molecular weight of 275.22 g/mol, XLogP of 2.95, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dinitroanilino)phenol is sourced from PubChem (CID 3100915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).