C17H21N3O3 — CID 31011892
5-methyl-N-[2-(2-methylpropanoylamino)ethyl]-2-phenyl-1,3-oxazole-4-carboxamide (PubChem CID 31011892) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 5-methyl-N-[2-(2-methylpropanoylamino)ethyl]-2-phenyl-1,3-oxazole-4-carboxamide.
| Compound Name | 5-methyl-N-[2-(2-methylpropanoylamino)ethyl]-2-phenyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 31011892 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 5-methyl-N-[2-(2-methylpropanoylamino)ethyl]-2-phenyl-1,3-oxazole-4-carboxamide |
| SMILES | Cc1oc(-c2ccccc2)nc1C(=O)NCCNC(=O)C(C)C |
| InChI | InChI=1S/C17H21N3O3/c1-11(2)15(21)18-9-10-19-16(22)14-12(3)23-17(20-14)13-7-5-4-6-8-13/h4-8,11H,9-10H2,1-3H3,(H,18,21)(H,19,22) |
| InChIKey | JHMVTQDAFSJHHX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|