C20H25N3O4 — CID 31011970
N-[(2R)-1-[2-(2-methylpropanoylamino)ethylamino]-1-oxo-3-phenylpropan-2-yl]furan-2-carboxamide (PubChem CID 31011970) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[(2R)-1-[2-(2-methylpropanoylamino)ethylamino]-1-oxo-3-phenylpropan-2-yl]furan-2-carboxamide.
| Compound Name | N-[(2R)-1-[2-(2-methylpropanoylamino)ethylamino]-1-oxo-3-phenylpropan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 31011970 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | N-[(2R)-1-[2-(2-methylpropanoylamino)ethylamino]-1-oxo-3-phenylpropan-2-yl]furan-2-carboxamide |
| SMILES | CC(C)C(=O)NCCNC(=O)[C@@H](Cc1ccccc1)NC(=O)c1ccco1 |
| InChI | InChI=1S/C20H25N3O4/c1-14(2)18(24)21-10-11-22-19(25)16(13-15-7-4-3-5-8-15)23-20(26)17-9-6-12-27-17/h3-9,12,14,16H,10-11,13H2,1-2H3,(H,21,24)(H,22,25)(H,23,26)/t16-/m1/s1 |
| InChIKey | SVSVNIFAEGCTTF-MRXNPFEDSA-N |
| XLogP | 1.51 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|