C22H25N3O4 — CID 3101232
benzyl N-[3-(1H-indol-3-yl)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]carbamate (PubChem CID 3101232) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is benzyl N-[3-(1H-indol-3-yl)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[3-(1H-indol-3-yl)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 3101232 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | benzyl N-[3-(1H-indol-3-yl)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]carbamate |
| SMILES | COCCNC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H25N3O4/c1-28-12-11-23-21(26)20(13-17-14-24-19-10-6-5-9-18(17)19)25-22(27)29-15-16-7-3-2-4-8-16/h2-10,14,20,24H,11-13,15H2,1H3,(H,23,26)(H,25,27) |
| InChIKey | BJYRINNUQDRHGN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|