About 3-[3-(4-bromophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-2-chloro-7-methylquinoline
3-[3-(4-bromophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-2-chloro-7-methylquinoline (PubChem CID 3101627) has the molecular formula C19H15BrClN3
and a molecular weight of 400.71 g/mol. Its IUPAC name is 3-[3-(4-bromophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-2-chloro-7-methylquinoline.
Molecular Properties
| Compound Name | 3-[3-(4-bromophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-2-chloro-7-methylquinoline |
| PubChem CID | 3101627 |
| Molecular Formula | C19H15BrClN3 |
| Molecular Weight | 400.71 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | 3-[3-(4-bromophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-2-chloro-7-methylquinoline |
| SMILES | Cc1ccc2cc(C3CC(c4ccc(Br)cc4)=NN3)c(Cl)nc2c1 |
| InChI | InChI=1S/C19H15BrClN3/c1-11-2-3-13-9-15(19(21)22-16(13)8-11)18-10-17(23-24-18)12-4-6-14(20)7-5-12/h2-9,18,24H,10H2,1H3 |
| InChIKey | LQWLMXRCJMTFCE-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.71 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(4-bromophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-2-chloro-7-methylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(4-bromophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-2-chloro-7-methylquinoline?
The IUPAC name of 3-[3-(4-bromophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-2-chloro-7-methylquinoline (CID 3101627) is 3-[3-(4-bromophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-2-chloro-7-methylquinoline.
What is the SMILES notation for 3-[3-(4-bromophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-2-chloro-7-methylquinoline?
The canonical SMILES for 3-[3-(4-bromophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-2-chloro-7-methylquinoline is Cc1ccc2cc(C3CC(c4ccc(Br)cc4)=NN3)c(Cl)nc2c1.
What is the InChIKey of 3-[3-(4-bromophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-2-chloro-7-methylquinoline?
The InChIKey is LQWLMXRCJMTFCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15BrClN3/c1-11-2-3-13-9-15(19(21)22-16(13)8-11)18-10-17(23-24-18)12-4-6-14(20)7-5-12/h2-9,18,24H,10H2,1H3.
What are the key properties of 3-[3-(4-bromophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-2-chloro-7-methylquinoline?
3-[3-(4-bromophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-2-chloro-7-methylquinoline has a molecular weight of 400.71 g/mol, XLogP of 5.40, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(4-bromophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-2-chloro-7-methylquinoline is sourced from PubChem (CID 3101627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).