C24H28N2O — CID 31016479
N-[2-(3-methylbut-2-enyl)-3,4-dihydro-1H-isoquinolin-7-yl]-1-phenylcyclopropane-1-carboxamide (PubChem CID 31016479) has the molecular formula C24H28N2O and a molecular weight of 360.50 g/mol. Its IUPAC name is N-[2-(3-methylbut-2-enyl)-3,4-dihydro-1H-isoquinolin-7-yl]-1-phenylcyclopropane-1-carboxamide.
| Compound Name | N-[2-(3-methylbut-2-enyl)-3,4-dihydro-1H-isoquinolin-7-yl]-1-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 31016479 |
| Molecular Formula | C24H28N2O |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | N-[2-(3-methylbut-2-enyl)-3,4-dihydro-1H-isoquinolin-7-yl]-1-phenylcyclopropane-1-carboxamide |
| SMILES | CC(C)=CCN1CCc2ccc(NC(=O)C3(c4ccccc4)CC3)cc2C1 |
| InChI | InChI=1S/C24H28N2O/c1-18(2)10-14-26-15-11-19-8-9-22(16-20(19)17-26)25-23(27)24(12-13-24)21-6-4-3-5-7-21/h3-10,16H,11-15,17H2,1-2H3,(H,25,27) |
| InChIKey | JRQNRLPSOUFMED-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|