C20H24N2O3 — CID 31017501
4-[(2R)-1-oxo-1-[[(2S)-4-phenylbutan-2-yl]amino]propan-2-yl]oxybenzamide (PubChem CID 31017501) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 4-[(2R)-1-oxo-1-[[(2S)-4-phenylbutan-2-yl]amino]propan-2-yl]oxybenzamide.
| Compound Name | 4-[(2R)-1-oxo-1-[[(2S)-4-phenylbutan-2-yl]amino]propan-2-yl]oxybenzamide |
|---|---|
| PubChem CID | 31017501 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 4-[(2R)-1-oxo-1-[[(2S)-4-phenylbutan-2-yl]amino]propan-2-yl]oxybenzamide |
| SMILES | C[C@@H](CCc1ccccc1)NC(=O)[C@@H](C)Oc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C20H24N2O3/c1-14(8-9-16-6-4-3-5-7-16)22-20(24)15(2)25-18-12-10-17(11-13-18)19(21)23/h3-7,10-15H,8-9H2,1-2H3,(H2,21,23)(H,22,24)/t14-,15+/m0/s1 |
| InChIKey | XKYQAEGZYFWTRL-LSDHHAIUSA-N |
| XLogP | 2.69 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |