About 4-[4-[4-[(2,2-dimethylmorpholin-4-yl)methyl]triazol-1-yl]piperidin-1-yl]pyrimidin-2-amine
4-[4-[4-[(2,2-dimethylmorpholin-4-yl)methyl]triazol-1-yl]piperidin-1-yl]pyrimidin-2-amine (PubChem CID 31017533) has the molecular formula C18H28N8O
and a molecular weight of 372.48 g/mol. Its IUPAC name is 4-[4-[4-[(2,2-dimethylmorpholin-4-yl)methyl]triazol-1-yl]piperidin-1-yl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-[4-[4-[(2,2-dimethylmorpholin-4-yl)methyl]triazol-1-yl]piperidin-1-yl]pyrimidin-2-amine |
| PubChem CID | 31017533 |
| Molecular Formula | C18H28N8O |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 4-[4-[4-[(2,2-dimethylmorpholin-4-yl)methyl]triazol-1-yl]piperidin-1-yl]pyrimidin-2-amine |
| SMILES | CC1(C)CN(Cc2cn(C3CCN(c4ccnc(N)n4)CC3)nn2)CCO1 |
| InChI | InChI=1S/C18H28N8O/c1-18(2)13-24(9-10-27-18)11-14-12-26(23-22-14)15-4-7-25(8-5-15)16-3-6-20-17(19)21-16/h3,6,12,15H,4-5,7-11,13H2,1-2H3,(H2,19,20,21) |
| InChIKey | ZWCJRJWYOKCYKH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 4-[4-[4-[(2,2-dimethylmorpholin-4-yl)methyl]triazol-1-yl]piperidin-1-yl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[4-[(2,2-dimethylmorpholin-4-yl)methyl]triazol-1-yl]piperidin-1-yl]pyrimidin-2-amine?
The IUPAC name of 4-[4-[4-[(2,2-dimethylmorpholin-4-yl)methyl]triazol-1-yl]piperidin-1-yl]pyrimidin-2-amine (CID 31017533) is 4-[4-[4-[(2,2-dimethylmorpholin-4-yl)methyl]triazol-1-yl]piperidin-1-yl]pyrimidin-2-amine.
What is the SMILES notation for 4-[4-[4-[(2,2-dimethylmorpholin-4-yl)methyl]triazol-1-yl]piperidin-1-yl]pyrimidin-2-amine?
The canonical SMILES for 4-[4-[4-[(2,2-dimethylmorpholin-4-yl)methyl]triazol-1-yl]piperidin-1-yl]pyrimidin-2-amine is CC1(C)CN(Cc2cn(C3CCN(c4ccnc(N)n4)CC3)nn2)CCO1.
What is the InChIKey of 4-[4-[4-[(2,2-dimethylmorpholin-4-yl)methyl]triazol-1-yl]piperidin-1-yl]pyrimidin-2-amine?
The InChIKey is ZWCJRJWYOKCYKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N8O/c1-18(2)13-24(9-10-27-18)11-14-12-26(23-22-14)15-4-7-25(8-5-15)16-3-6-20-17(19)21-16/h3,6,12,15H,4-5,7-11,13H2,1-2H3,(H2,19,20,21).
What are the key properties of 4-[4-[4-[(2,2-dimethylmorpholin-4-yl)methyl]triazol-1-yl]piperidin-1-yl]pyrimidin-2-amine?
4-[4-[4-[(2,2-dimethylmorpholin-4-yl)methyl]triazol-1-yl]piperidin-1-yl]pyrimidin-2-amine has a molecular weight of 372.48 g/mol, XLogP of 1.10, 4 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[4-[(2,2-dimethylmorpholin-4-yl)methyl]triazol-1-yl]piperidin-1-yl]pyrimidin-2-amine is sourced from PubChem (CID 31017533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).