C19H30N6 — CID 31017893
4-[4-(cyclohexylmethyl)triazol-1-yl]-1-[(5-methyl-1H-imidazol-4-yl)methyl]piperidine (PubChem CID 31017893) has the molecular formula C19H30N6 and a molecular weight of 342.49 g/mol. Its IUPAC name is 4-[4-(cyclohexylmethyl)triazol-1-yl]-1-[(5-methyl-1H-imidazol-4-yl)methyl]piperidine.
| Compound Name | 4-[4-(cyclohexylmethyl)triazol-1-yl]-1-[(5-methyl-1H-imidazol-4-yl)methyl]piperidine |
|---|---|
| PubChem CID | 31017893 |
| Molecular Formula | C19H30N6 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | 4-[4-(cyclohexylmethyl)triazol-1-yl]-1-[(5-methyl-1H-imidazol-4-yl)methyl]piperidine |
| SMILES | Cc1[nH]cnc1CN1CCC(n2cc(CC3CCCCC3)nn2)CC1 |
| InChI | InChI=1S/C19H30N6/c1-15-19(21-14-20-15)13-24-9-7-18(8-10-24)25-12-17(22-23-25)11-16-5-3-2-4-6-16/h12,14,16,18H,2-11,13H2,1H3,(H,20,21) |
| InChIKey | FHLJHNKLBYMUJP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |