C21H11NO4 — CID 3101909
8-(5-phenyl-1,3-oxazol-2-yl)-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione (PubChem CID 3101909) has the molecular formula C21H11NO4 and a molecular weight of 341.32 g/mol. Its IUPAC name is 8-(5-phenyl-1,3-oxazol-2-yl)-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione.
| Compound Name | 8-(5-phenyl-1,3-oxazol-2-yl)-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
|---|---|
| PubChem CID | 3101909 |
| Molecular Formula | C21H11NO4 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 8-(5-phenyl-1,3-oxazol-2-yl)-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
| SMILES | O=C1OC(=O)c2ccc(-c3ncc(-c4ccccc4)o3)c3cccc1c23 |
| InChI | InChI=1S/C21H11NO4/c23-20-15-8-4-7-13-14(9-10-16(18(13)15)21(24)26-20)19-22-11-17(25-19)12-5-2-1-3-6-12/h1-11H |
| InChIKey | IGCDWDXTARNDAS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|