C17H20F12N2O2 — CID 3101998
2,2,3,3,4,4,4-heptafluoro-N-[[1,3,3-trimethyl-5-(2,2,3,3,3-pentafluoropropanoylamino)cyclohexyl]methyl]butanamide (PubChem CID 3101998) has the molecular formula C17H20F12N2O2 and a molecular weight of 512.34 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-[[1,3,3-trimethyl-5-(2,2,3,3,3-pentafluoropropanoylamino)cyclohexyl]methyl]butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-[[1,3,3-trimethyl-5-(2,2,3,3,3-pentafluoropropanoylamino)cyclohexyl]methyl]butanamide |
|---|---|
| PubChem CID | 3101998 |
| Molecular Formula | C17H20F12N2O2 |
| Molecular Weight | 512.34 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-[[1,3,3-trimethyl-5-(2,2,3,3,3-pentafluoropropanoylamino)cyclohexyl]methyl]butanamide |
| SMILES | CC1(C)CC(NC(=O)C(F)(F)C(F)(F)F)CC(C)(CNC(=O)C(F)(F)C(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C17H20F12N2O2/c1-11(2)4-8(31-10(33)14(20,21)16(24,25)26)5-12(3,6-11)7-30-9(32)13(18,19)15(22,23)17(27,28)29/h8H,4-7H2,1-3H3,(H,30,32)(H,31,33) |
| InChIKey | WNPQXPLODMJWBL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.34 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|