About N-butyl-N-[1-[(2,6-dimethylphenyl)carbamoyl]cyclohexyl]pyridine-2-carboxamide
N-butyl-N-[1-[(2,6-dimethylphenyl)carbamoyl]cyclohexyl]pyridine-2-carboxamide (PubChem CID 3102026) has the molecular formula C25H33N3O2
and a molecular weight of 407.56 g/mol. Its IUPAC name is N-butyl-N-[1-[(2,6-dimethylphenyl)carbamoyl]cyclohexyl]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | N-butyl-N-[1-[(2,6-dimethylphenyl)carbamoyl]cyclohexyl]pyridine-2-carboxamide |
| PubChem CID | 3102026 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | N-butyl-N-[1-[(2,6-dimethylphenyl)carbamoyl]cyclohexyl]pyridine-2-carboxamide |
| SMILES | CCCCN(C(=O)c1ccccn1)C1(C(=O)Nc2c(C)cccc2C)CCCCC1 |
| InChI | InChI=1S/C25H33N3O2/c1-4-5-18-28(23(29)21-14-7-10-17-26-21)25(15-8-6-9-16-25)24(30)27-22-19(2)12-11-13-20(22)3/h7,10-14,17H,4-6,8-9,15-16,18H2,1-3H3,(H,27,30) |
| InChIKey | HBTLHDKGXBMCCA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-butyl-N-[1-[(2,6-dimethylphenyl)carbamoyl]cyclohexyl]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-[1-[(2,6-dimethylphenyl)carbamoyl]cyclohexyl]pyridine-2-carboxamide?
The IUPAC name of N-butyl-N-[1-[(2,6-dimethylphenyl)carbamoyl]cyclohexyl]pyridine-2-carboxamide (CID 3102026) is N-butyl-N-[1-[(2,6-dimethylphenyl)carbamoyl]cyclohexyl]pyridine-2-carboxamide.
What is the SMILES notation for N-butyl-N-[1-[(2,6-dimethylphenyl)carbamoyl]cyclohexyl]pyridine-2-carboxamide?
The canonical SMILES for N-butyl-N-[1-[(2,6-dimethylphenyl)carbamoyl]cyclohexyl]pyridine-2-carboxamide is CCCCN(C(=O)c1ccccn1)C1(C(=O)Nc2c(C)cccc2C)CCCCC1.
What is the InChIKey of N-butyl-N-[1-[(2,6-dimethylphenyl)carbamoyl]cyclohexyl]pyridine-2-carboxamide?
The InChIKey is HBTLHDKGXBMCCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H33N3O2/c1-4-5-18-28(23(29)21-14-7-10-17-26-21)25(15-8-6-9-16-25)24(30)27-22-19(2)12-11-13-20(22)3/h7,10-14,17H,4-6,8-9,15-16,18H2,1-3H3,(H,27,30).
What are the key properties of N-butyl-N-[1-[(2,6-dimethylphenyl)carbamoyl]cyclohexyl]pyridine-2-carboxamide?
N-butyl-N-[1-[(2,6-dimethylphenyl)carbamoyl]cyclohexyl]pyridine-2-carboxamide has a molecular weight of 407.56 g/mol, XLogP of 5.28, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-[1-[(2,6-dimethylphenyl)carbamoyl]cyclohexyl]pyridine-2-carboxamide is sourced from PubChem (CID 3102026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).