C19H24N2O4 — CID 3102210
4-(3,4-dimethoxyphenyl)-1,7,7-trimethyl-3,4,6,8-tetrahydroquinazoline-2,5-dione (PubChem CID 3102210) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-1,7,7-trimethyl-3,4,6,8-tetrahydroquinazoline-2,5-dione.
| Compound Name | 4-(3,4-dimethoxyphenyl)-1,7,7-trimethyl-3,4,6,8-tetrahydroquinazoline-2,5-dione |
|---|---|
| PubChem CID | 3102210 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-1,7,7-trimethyl-3,4,6,8-tetrahydroquinazoline-2,5-dione |
| SMILES | COc1ccc(C2NC(=O)N(C)C3=C2C(=O)CC(C)(C)C3)cc1OC |
| InChI | InChI=1S/C19H24N2O4/c1-19(2)9-12-16(13(22)10-19)17(20-18(23)21(12)3)11-6-7-14(24-4)15(8-11)25-5/h6-8,17H,9-10H2,1-5H3,(H,20,23) |
| InChIKey | LYLUEUXBYYJESL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |