About N-[(2,4-dihydroxyphenyl)methylideneamino]-N'-pyridin-2-ylpyridine-2-carboximidamide
N-[(2,4-dihydroxyphenyl)methylideneamino]-N'-pyridin-2-ylpyridine-2-carboximidamide (PubChem CID 3102285) has the molecular formula C18H15N5O2
and a molecular weight of 333.35 g/mol. Its IUPAC name is N-[(2,4-dihydroxyphenyl)methylideneamino]-N'-pyridin-2-ylpyridine-2-carboximidamide.
Molecular Properties
| Compound Name | N-[(2,4-dihydroxyphenyl)methylideneamino]-N'-pyridin-2-ylpyridine-2-carboximidamide |
| PubChem CID | 3102285 |
| Molecular Formula | C18H15N5O2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | N-[(2,4-dihydroxyphenyl)methylideneamino]-N'-pyridin-2-ylpyridine-2-carboximidamide |
| SMILES | Oc1ccc(C=NNC(=Nc2ccccn2)c2ccccn2)c(O)c1 |
| InChI | InChI=1S/C18H15N5O2/c24-14-8-7-13(16(25)11-14)12-21-23-18(15-5-1-3-9-19-15)22-17-6-2-4-10-20-17/h1-12,24-25H,(H,20,22,23) |
| InChIKey | YRXFIJVTJBYLBP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 102.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(2,4-dihydroxyphenyl)methylideneamino]-N'-pyridin-2-ylpyridine-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,4-dihydroxyphenyl)methylideneamino]-N'-pyridin-2-ylpyridine-2-carboximidamide?
The IUPAC name of N-[(2,4-dihydroxyphenyl)methylideneamino]-N'-pyridin-2-ylpyridine-2-carboximidamide (CID 3102285) is N-[(2,4-dihydroxyphenyl)methylideneamino]-N'-pyridin-2-ylpyridine-2-carboximidamide.
What is the SMILES notation for N-[(2,4-dihydroxyphenyl)methylideneamino]-N'-pyridin-2-ylpyridine-2-carboximidamide?
The canonical SMILES for N-[(2,4-dihydroxyphenyl)methylideneamino]-N'-pyridin-2-ylpyridine-2-carboximidamide is Oc1ccc(C=NNC(=Nc2ccccn2)c2ccccn2)c(O)c1.
What is the InChIKey of N-[(2,4-dihydroxyphenyl)methylideneamino]-N'-pyridin-2-ylpyridine-2-carboximidamide?
The InChIKey is YRXFIJVTJBYLBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N5O2/c24-14-8-7-13(16(25)11-14)12-21-23-18(15-5-1-3-9-19-15)22-17-6-2-4-10-20-17/h1-12,24-25H,(H,20,22,23).
What are the key properties of N-[(2,4-dihydroxyphenyl)methylideneamino]-N'-pyridin-2-ylpyridine-2-carboximidamide?
N-[(2,4-dihydroxyphenyl)methylideneamino]-N'-pyridin-2-ylpyridine-2-carboximidamide has a molecular weight of 333.35 g/mol, XLogP of 2.59, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,4-dihydroxyphenyl)methylideneamino]-N'-pyridin-2-ylpyridine-2-carboximidamide is sourced from PubChem (CID 3102285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).