About N'-benzyl-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide
N'-benzyl-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide (PubChem CID 3102469) has the molecular formula C19H22N2O4
and a molecular weight of 342.40 g/mol. Its IUPAC name is N'-benzyl-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide.
Molecular Properties
| Compound Name | N'-benzyl-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide |
| PubChem CID | 3102469 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | N'-benzyl-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide |
| SMILES | COc1ccc(CCNC(=O)C(=O)NCc2ccccc2)cc1OC |
| InChI | InChI=1S/C19H22N2O4/c1-24-16-9-8-14(12-17(16)25-2)10-11-20-18(22)19(23)21-13-15-6-4-3-5-7-15/h3-9,12H,10-11,13H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | FFHXZVUORQAZPL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-benzyl-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzyl-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide?
The IUPAC name of N'-benzyl-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide (CID 3102469) is N'-benzyl-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide.
What is the SMILES notation for N'-benzyl-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide?
The canonical SMILES for N'-benzyl-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide is COc1ccc(CCNC(=O)C(=O)NCc2ccccc2)cc1OC.
What is the InChIKey of N'-benzyl-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide?
The InChIKey is FFHXZVUORQAZPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O4/c1-24-16-9-8-14(12-17(16)25-2)10-11-20-18(22)19(23)21-13-15-6-4-3-5-7-15/h3-9,12H,10-11,13H2,1-2H3,(H,20,22)(H,21,23).
What are the key properties of N'-benzyl-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide?
N'-benzyl-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide has a molecular weight of 342.40 g/mol, XLogP of 1.68, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzyl-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide is sourced from PubChem (CID 3102469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).