2-(5H-indeno[1,2-b]pyridin-5-yl)acetic acid

C14H11NO2 — CID 3102865

IUPAC2-(5H-indeno[1,2-b]pyridin-5-yl)acetic acid
SMILESO=C(O)CC1c2ccccc2-c2ncccc21
InChIInChI=1S/C14H11NO2/c16-13(17)8-12-9-4-1-2-5-10(9)14-11(12)6-3-7-15-14/h1-7,12H,8H2,(H,16,17)
InChIKeyKTQGALMNKCFSMZ-UHFFFAOYSA-N
MW225.25 g/mol
LogP2.67
Rot. Bonds2

About 2-(5H-indeno[1,2-b]pyridin-5-yl)acetic acid

2-(5H-indeno[1,2-b]pyridin-5-yl)acetic acid (PubChem CID 3102865) has the molecular formula C14H11NO2 and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-(5H-indeno[1,2-b]pyridin-5-yl)acetic acid.

Molecular Properties

Compound Name2-(5H-indeno[1,2-b]pyridin-5-yl)acetic acid
PubChem CID3102865
Molecular FormulaC14H11NO2
Molecular Weight225.25 g/mol
Exact Mass225.08
IUPAC Name2-(5H-indeno[1,2-b]pyridin-5-yl)acetic acid
SMILESO=C(O)CC1c2ccccc2-c2ncccc21
InChIInChI=1S/C14H11NO2/c16-13(17)8-12-9-4-1-2-5-10(9)14-11(12)6-3-7-15-14/h1-7,12H,8H2,(H,16,17)
InChIKeyKTQGALMNKCFSMZ-UHFFFAOYSA-N
XLogP2.67
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.25
LogP ≤ 52.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(5H-indeno[1,2-b]pyridin-5-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5H-indeno[1,2-b]pyridin-5-yl)acetic acid?
The IUPAC name of 2-(5H-indeno[1,2-b]pyridin-5-yl)acetic acid (CID 3102865) is 2-(5H-indeno[1,2-b]pyridin-5-yl)acetic acid.
What is the SMILES notation for 2-(5H-indeno[1,2-b]pyridin-5-yl)acetic acid?
The canonical SMILES for 2-(5H-indeno[1,2-b]pyridin-5-yl)acetic acid is O=C(O)CC1c2ccccc2-c2ncccc21.
What is the InChIKey of 2-(5H-indeno[1,2-b]pyridin-5-yl)acetic acid?
The InChIKey is KTQGALMNKCFSMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO2/c16-13(17)8-12-9-4-1-2-5-10(9)14-11(12)6-3-7-15-14/h1-7,12H,8H2,(H,16,17).
What are the key properties of 2-(5H-indeno[1,2-b]pyridin-5-yl)acetic acid?
2-(5H-indeno[1,2-b]pyridin-5-yl)acetic acid has a molecular weight of 225.25 g/mol, XLogP of 2.67, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5H-indeno[1,2-b]pyridin-5-yl)acetic acid is sourced from PubChem (CID 3102865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).