About methyl N-[3-(5-hydroxy-1,3-dimethyl-2-oxoindol-3-yl)propyl]-N-methylcarbamate
methyl N-[3-(5-hydroxy-1,3-dimethyl-2-oxoindol-3-yl)propyl]-N-methylcarbamate (PubChem CID 3102997) has the molecular formula C16H22N2O4
and a molecular weight of 306.36 g/mol. Its IUPAC name is methyl N-[3-(5-hydroxy-1,3-dimethyl-2-oxoindol-3-yl)propyl]-N-methylcarbamate.
Molecular Properties
| Compound Name | methyl N-[3-(5-hydroxy-1,3-dimethyl-2-oxoindol-3-yl)propyl]-N-methylcarbamate |
| PubChem CID | 3102997 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | methyl N-[3-(5-hydroxy-1,3-dimethyl-2-oxoindol-3-yl)propyl]-N-methylcarbamate |
| SMILES | COC(=O)N(C)CCCC1(C)C(=O)N(C)c2ccc(O)cc21 |
| InChI | InChI=1S/C16H22N2O4/c1-16(8-5-9-17(2)15(21)22-4)12-10-11(19)6-7-13(12)18(3)14(16)20/h6-7,10,19H,5,8-9H2,1-4H3 |
| InChIKey | OWWLUEIFOIPLRY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl N-[3-(5-hydroxy-1,3-dimethyl-2-oxoindol-3-yl)propyl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[3-(5-hydroxy-1,3-dimethyl-2-oxoindol-3-yl)propyl]-N-methylcarbamate?
The IUPAC name of methyl N-[3-(5-hydroxy-1,3-dimethyl-2-oxoindol-3-yl)propyl]-N-methylcarbamate (CID 3102997) is methyl N-[3-(5-hydroxy-1,3-dimethyl-2-oxoindol-3-yl)propyl]-N-methylcarbamate.
What is the SMILES notation for methyl N-[3-(5-hydroxy-1,3-dimethyl-2-oxoindol-3-yl)propyl]-N-methylcarbamate?
The canonical SMILES for methyl N-[3-(5-hydroxy-1,3-dimethyl-2-oxoindol-3-yl)propyl]-N-methylcarbamate is COC(=O)N(C)CCCC1(C)C(=O)N(C)c2ccc(O)cc21.
What is the InChIKey of methyl N-[3-(5-hydroxy-1,3-dimethyl-2-oxoindol-3-yl)propyl]-N-methylcarbamate?
The InChIKey is OWWLUEIFOIPLRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O4/c1-16(8-5-9-17(2)15(21)22-4)12-10-11(19)6-7-13(12)18(3)14(16)20/h6-7,10,19H,5,8-9H2,1-4H3.
What are the key properties of methyl N-[3-(5-hydroxy-1,3-dimethyl-2-oxoindol-3-yl)propyl]-N-methylcarbamate?
methyl N-[3-(5-hydroxy-1,3-dimethyl-2-oxoindol-3-yl)propyl]-N-methylcarbamate has a molecular weight of 306.36 g/mol, XLogP of 2.10, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[3-(5-hydroxy-1,3-dimethyl-2-oxoindol-3-yl)propyl]-N-methylcarbamate is sourced from PubChem (CID 3102997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).