About 1-[4-(2,4-dipentylphenoxy)butyl]-3-methylpyridin-1-ium
1-[4-(2,4-dipentylphenoxy)butyl]-3-methylpyridin-1-ium (PubChem CID 3103107) has the molecular formula C26H40NO+
and a molecular weight of 382.61 g/mol. Its IUPAC name is 1-[4-(2,4-dipentylphenoxy)butyl]-3-methylpyridin-1-ium.
Molecular Properties
| Compound Name | 1-[4-(2,4-dipentylphenoxy)butyl]-3-methylpyridin-1-ium |
| PubChem CID | 3103107 |
| Molecular Formula | C26H40NO+ |
| Molecular Weight | 382.61 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | 1-[4-(2,4-dipentylphenoxy)butyl]-3-methylpyridin-1-ium |
| SMILES | CCCCCc1ccc(OCCCC[n+]2cccc(C)c2)c(CCCCC)c1 |
| InChI | InChI=1S/C26H40NO/c1-4-6-8-14-24-16-17-26(25(21-24)15-9-7-5-2)28-20-11-10-18-27-19-12-13-23(3)22-27/h12-13,16-17,19,21-22H,4-11,14-15,18,20H2,1-3H3/q+1 |
| InChIKey | NRVQIWQMLUFSOV-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.61 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(2,4-dipentylphenoxy)butyl]-3-methylpyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2,4-dipentylphenoxy)butyl]-3-methylpyridin-1-ium?
The IUPAC name of 1-[4-(2,4-dipentylphenoxy)butyl]-3-methylpyridin-1-ium (CID 3103107) is 1-[4-(2,4-dipentylphenoxy)butyl]-3-methylpyridin-1-ium.
What is the SMILES notation for 1-[4-(2,4-dipentylphenoxy)butyl]-3-methylpyridin-1-ium?
The canonical SMILES for 1-[4-(2,4-dipentylphenoxy)butyl]-3-methylpyridin-1-ium is CCCCCc1ccc(OCCCC[n+]2cccc(C)c2)c(CCCCC)c1.
What is the InChIKey of 1-[4-(2,4-dipentylphenoxy)butyl]-3-methylpyridin-1-ium?
The InChIKey is NRVQIWQMLUFSOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H40NO/c1-4-6-8-14-24-16-17-26(25(21-24)15-9-7-5-2)28-20-11-10-18-27-19-12-13-23(3)22-27/h12-13,16-17,19,21-22H,4-11,14-15,18,20H2,1-3H3/q+1.
What are the key properties of 1-[4-(2,4-dipentylphenoxy)butyl]-3-methylpyridin-1-ium?
1-[4-(2,4-dipentylphenoxy)butyl]-3-methylpyridin-1-ium has a molecular weight of 382.61 g/mol, XLogP of 6.61, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2,4-dipentylphenoxy)butyl]-3-methylpyridin-1-ium is sourced from PubChem (CID 3103107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).