C18H24N2O3S2 — CID 3103190
2-ethylsulfanylethyl 4-(2-ethoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 3103190) has the molecular formula C18H24N2O3S2 and a molecular weight of 380.54 g/mol. Its IUPAC name is 2-ethylsulfanylethyl 4-(2-ethoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | 2-ethylsulfanylethyl 4-(2-ethoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 3103190 |
| Molecular Formula | C18H24N2O3S2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 2-ethylsulfanylethyl 4-(2-ethoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOc1ccccc1C1NC(=S)NC(C)=C1C(=O)OCCSCC |
| InChI | InChI=1S/C18H24N2O3S2/c1-4-22-14-9-7-6-8-13(14)16-15(12(3)19-18(24)20-16)17(21)23-10-11-25-5-2/h6-9,16H,4-5,10-11H2,1-3H3,(H2,19,20,24) |
| InChIKey | QBSCSBAOMVNCKQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|