C20H28N4O3 — CID 31034383
4-[(2R)-2-hydroxy-3-[4-(piperidine-1-carbonyl)piperazin-1-yl]propoxy]benzonitrile (PubChem CID 31034383) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is 4-[(2R)-2-hydroxy-3-[4-(piperidine-1-carbonyl)piperazin-1-yl]propoxy]benzonitrile.
| Compound Name | 4-[(2R)-2-hydroxy-3-[4-(piperidine-1-carbonyl)piperazin-1-yl]propoxy]benzonitrile |
|---|---|
| PubChem CID | 31034383 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 4-[(2R)-2-hydroxy-3-[4-(piperidine-1-carbonyl)piperazin-1-yl]propoxy]benzonitrile |
| SMILES | N#Cc1ccc(OC[C@H](O)CN2CCN(C(=O)N3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C20H28N4O3/c21-14-17-4-6-19(7-5-17)27-16-18(25)15-22-10-12-24(13-11-22)20(26)23-8-2-1-3-9-23/h4-7,18,25H,1-3,8-13,15-16H2/t18-/m1/s1 |
| InChIKey | XKTNNYYRXLJRPI-GOSISDBHSA-N |
| XLogP | 1.52 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |