C16H21ClN4O3S — CID 31036115
4-[[4-[(6-chloro-3-pyridinyl)methyl]-1,4-diazepan-1-yl]sulfonyl]-3,5-dimethyl-1,2-oxazole (PubChem CID 31036115) has the molecular formula C16H21ClN4O3S and a molecular weight of 384.89 g/mol. Its IUPAC name is 4-[[4-[(6-chloro-3-pyridinyl)methyl]-1,4-diazepan-1-yl]sulfonyl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[[4-[(6-chloro-3-pyridinyl)methyl]-1,4-diazepan-1-yl]sulfonyl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 31036115 |
| Molecular Formula | C16H21ClN4O3S |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 4-[[4-[(6-chloro-3-pyridinyl)methyl]-1,4-diazepan-1-yl]sulfonyl]-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCCN(Cc2ccc(Cl)nc2)CC1 |
| InChI | InChI=1S/C16H21ClN4O3S/c1-12-16(13(2)24-19-12)25(22,23)21-7-3-6-20(8-9-21)11-14-4-5-15(17)18-10-14/h4-5,10H,3,6-9,11H2,1-2H3 |
| InChIKey | KPUZTSHXCVJOBY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|