About cyclohexyl 3-[(3S)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoate
cyclohexyl 3-[(3S)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoate (PubChem CID 31038327) has the molecular formula C18H23NO3
and a molecular weight of 301.39 g/mol. Its IUPAC name is cyclohexyl 3-[(3S)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoate.
Molecular Properties
| Compound Name | cyclohexyl 3-[(3S)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoate |
| PubChem CID | 31038327 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | cyclohexyl 3-[(3S)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoate |
| SMILES | O=C(CC[C@H]1Cc2ccccc2NC1=O)OC1CCCCC1 |
| InChI | InChI=1S/C18H23NO3/c20-17(22-15-7-2-1-3-8-15)11-10-14-12-13-6-4-5-9-16(13)19-18(14)21/h4-6,9,14-15H,1-3,7-8,10-12H2,(H,19,21)/t14-/m0/s1 |
| InChIKey | OJWVHUNOLNXSKL-AWEZNQCLSA-N |
| XLogP | 3.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexyl 3-[(3S)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 3-[(3S)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoate?
The IUPAC name of cyclohexyl 3-[(3S)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoate (CID 31038327) is cyclohexyl 3-[(3S)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoate.
What is the SMILES notation for cyclohexyl 3-[(3S)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoate?
The canonical SMILES for cyclohexyl 3-[(3S)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoate is O=C(CC[C@H]1Cc2ccccc2NC1=O)OC1CCCCC1.
What is the InChIKey of cyclohexyl 3-[(3S)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoate?
The InChIKey is OJWVHUNOLNXSKL-AWEZNQCLSA-N. The full InChI is InChI=1S/C18H23NO3/c20-17(22-15-7-2-1-3-8-15)11-10-14-12-13-6-4-5-9-16(13)19-18(14)21/h4-6,9,14-15H,1-3,7-8,10-12H2,(H,19,21)/t14-/m0/s1.
What are the key properties of cyclohexyl 3-[(3S)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoate?
cyclohexyl 3-[(3S)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoate has a molecular weight of 301.39 g/mol, XLogP of 3.45, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 3-[(3S)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoate is sourced from PubChem (CID 31038327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).